C12H9N5O — CID 58094010
8-amino-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one (PubChem CID 58094010) has the molecular formula C12H9N5O and a molecular weight of 239.24 g/mol. Its IUPAC name is 8-amino-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one.
| Compound Name | 8-amino-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 58094010 |
| Molecular Formula | C12H9N5O |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 8-amino-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one |
| SMILES | Nc1nc(-c2cncnc2)cc2cc[nH]c(=O)c12 |
| InChI | InChI=1S/C12H9N5O/c13-11-10-7(1-2-16-12(10)18)3-9(17-11)8-4-14-6-15-5-8/h1-6H,(H2,13,17)(H,16,18) |
| InChIKey | LTYLJFDCEDKSNX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |