About 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one
6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one (PubChem CID 58166594) has the molecular formula C17H20N6O
and a molecular weight of 324.39 g/mol. Its IUPAC name is 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one |
| PubChem CID | 58166594 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one |
| SMILES | CCC(C)(C)Nc1nc(-c2cnc(N)nc2)cc2cc[nH]c(=O)c12 |
| InChI | InChI=1S/C17H20N6O/c1-4-17(2,3)23-14-13-10(5-6-19-15(13)24)7-12(22-14)11-8-20-16(18)21-9-11/h5-9H,4H2,1-3H3,(H,19,24)(H,22,23)(H2,18,20,21) |
| InChIKey | JKTGWHQRKBELOB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one?
The IUPAC name of 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one (CID 58166594) is 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one is CCC(C)(C)Nc1nc(-c2cnc(N)nc2)cc2cc[nH]c(=O)c12.
What is the InChIKey of 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one?
The InChIKey is JKTGWHQRKBELOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N6O/c1-4-17(2,3)23-14-13-10(5-6-19-15(13)24)7-12(22-14)11-8-20-16(18)21-9-11/h5-9H,4H2,1-3H3,(H,19,24)(H,22,23)(H2,18,20,21).
What are the key properties of 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one?
6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one has a molecular weight of 324.39 g/mol, XLogP of 2.56, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-aminopyrimidin-5-yl)-8-(2-methylbutan-2-ylamino)-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 58166594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).