C9H4BrF2NO — CID 169118375
6-bromo-7,8-difluoro-2H-isoquinolin-1-one (PubChem CID 169118375) has the molecular formula C9H4BrF2NO and a molecular weight of 260.04 g/mol. Its IUPAC name is 6-bromo-7,8-difluoro-2H-isoquinolin-1-one.
| Compound Name | 6-bromo-7,8-difluoro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 169118375 |
| Molecular Formula | C9H4BrF2NO |
| Molecular Weight | 260.04 g/mol |
| Exact Mass | 258.94 |
| IUPAC Name | 6-bromo-7,8-difluoro-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]ccc2cc(Br)c(F)c(F)c12 |
| InChI | InChI=1S/C9H4BrF2NO/c10-5-3-4-1-2-13-9(14)6(4)8(12)7(5)11/h1-3H,(H,13,14) |
| InChIKey | SIQXYDPSWOTQJE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.04 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|