C9H9O2+ — CID 15256760
5,7-dimethylfuro[2,3-c]pyran-6-ium (PubChem CID 15256760) has the molecular formula C9H9O2+ and a molecular weight of 149.17 g/mol. Its IUPAC name is 5,7-dimethylfuro[2,3-c]pyran-6-ium.
| Compound Name | 5,7-dimethylfuro[2,3-c]pyran-6-ium |
|---|---|
| PubChem CID | 15256760 |
| Molecular Formula | C9H9O2+ |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 5,7-dimethylfuro[2,3-c]pyran-6-ium |
| SMILES | Cc1cc2ccoc2c(C)[o+]1 |
| InChI | InChI=1S/C9H9O2/c1-6-5-8-3-4-10-9(8)7(2)11-6/h3-5H,1-2H3/q+1 |
| InChIKey | XLRAEVPNHNMJEB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|