C17H28O — CID 156725009
5,7-dimethyl-4-propan-2-yl-1-benzofuran;ethane (PubChem CID 156725009) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 5,7-dimethyl-4-propan-2-yl-1-benzofuran;ethane.
| Compound Name | 5,7-dimethyl-4-propan-2-yl-1-benzofuran;ethane |
|---|---|
| PubChem CID | 156725009 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 5,7-dimethyl-4-propan-2-yl-1-benzofuran;ethane |
| SMILES | CC.CC.Cc1cc(C)c2occc2c1C(C)C |
| InChI | InChI=1S/C13H16O.2C2H6/c1-8(2)12-9(3)7-10(4)13-11(12)5-6-14-13;2*1-2/h5-8H,1-4H3;2*1-2H3 |
| InChIKey | GMINLGNGDQGTGA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |