About ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene
ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene (PubChem CID 90692106) has the molecular formula C17H30
and a molecular weight of 234.43 g/mol. Its IUPAC name is ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene.
Analyze ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene?
The IUPAC name of ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene (CID 90692106) is ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene.
What is the SMILES notation for ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene?
The canonical SMILES for ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene is CC.Cc1cc(C)c(C(C)C)c(C(C)C)c1C.
What is the InChIKey of ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene?
The InChIKey is ZRNOILKWGXRNSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24.C2H6/c1-9(2)14-12(6)8-11(5)13(7)15(14)10(3)4;1-2/h8-10H,1-7H3;1-2H3.
What are the key properties of ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene?
ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene has a molecular weight of 234.43 g/mol, XLogP of 5.88, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,2,5-trimethyl-3,4-di(propan-2-yl)benzene is sourced from PubChem (CID 90692106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).