C16H23Cl — CID 83148455
3-(1-chloro-2-cyclopropylpropyl)-1,2,4,5-tetramethylbenzene (PubChem CID 83148455) has the molecular formula C16H23Cl and a molecular weight of 250.81 g/mol. Its IUPAC name is 3-(1-chloro-2-cyclopropylpropyl)-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-(1-chloro-2-cyclopropylpropyl)-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 83148455 |
| Molecular Formula | C16H23Cl |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-(1-chloro-2-cyclopropylpropyl)-1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)c(C(Cl)C(C)C2CC2)c1C |
| InChI | InChI=1S/C16H23Cl/c1-9-8-10(2)12(4)15(11(9)3)16(17)13(5)14-6-7-14/h8,13-14,16H,6-7H2,1-5H3 |
| InChIKey | GKZNCYOKJMKPDX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|