C16H25N — CID 43110265
cyclopentyl-(2,3,5,6-tetramethylphenyl)methanamine (PubChem CID 43110265) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is cyclopentyl-(2,3,5,6-tetramethylphenyl)methanamine.
| Compound Name | cyclopentyl-(2,3,5,6-tetramethylphenyl)methanamine |
|---|---|
| PubChem CID | 43110265 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | cyclopentyl-(2,3,5,6-tetramethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C)c(C(N)C2CCCC2)c1C |
| InChI | InChI=1S/C16H25N/c1-10-9-11(2)13(4)15(12(10)3)16(17)14-7-5-6-8-14/h9,14,16H,5-8,17H2,1-4H3 |
| InChIKey | UDMXORRNYHHFHB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |