C15H24ClNO — CID 171198721
4-[(R)-amino(cyclohexyl)methyl]-3,5-dimethylphenol;hydrochloride (PubChem CID 171198721) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 4-[(R)-amino(cyclohexyl)methyl]-3,5-dimethylphenol;hydrochloride.
| Compound Name | 4-[(R)-amino(cyclohexyl)methyl]-3,5-dimethylphenol;hydrochloride |
|---|---|
| PubChem CID | 171198721 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 4-[(R)-amino(cyclohexyl)methyl]-3,5-dimethylphenol;hydrochloride |
| SMILES | Cc1cc(O)cc(C)c1[C@H](N)C1CCCCC1.Cl |
| InChI | InChI=1S/C15H23NO.ClH/c1-10-8-13(17)9-11(2)14(10)15(16)12-6-4-3-5-7-12;/h8-9,12,15,17H,3-7,16H2,1-2H3;1H/t15-;/m1./s1 |
| InChIKey | GGYVDBIUJKNWAR-XFULWGLBSA-N |
| XLogP | 4.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |