C15H24ClNO3 — CID 171207108
2-[(R)-amino(cyclohexyl)methyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171207108) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is 2-[(R)-amino(cyclohexyl)methyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 2-[(R)-amino(cyclohexyl)methyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171207108 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[(R)-amino(cyclohexyl)methyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc(O)c([C@H](N)C2CCCCC2)c(OC)c1.Cl |
| InChI | InChI=1S/C15H23NO3.ClH/c1-18-11-8-12(17)14(13(9-11)19-2)15(16)10-6-4-3-5-7-10;/h8-10,15,17H,3-7,16H2,1-2H3;1H/t15-;/m1./s1 |
| InChIKey | TXCZKRWNUPTTNA-XFULWGLBSA-N |
| XLogP | 3.41 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|