C12H19NS — CID 115778964
cyclopentyl-(4,5-dimethylthiophen-2-yl)methanamine (PubChem CID 115778964) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is cyclopentyl-(4,5-dimethylthiophen-2-yl)methanamine.
| Compound Name | cyclopentyl-(4,5-dimethylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 115778964 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | cyclopentyl-(4,5-dimethylthiophen-2-yl)methanamine |
| SMILES | Cc1cc(C(N)C2CCCC2)sc1C |
| InChI | InChI=1S/C12H19NS/c1-8-7-11(14-9(8)2)12(13)10-5-3-4-6-10/h7,10,12H,3-6,13H2,1-2H3 |
| InChIKey | RWUZNXWCPHSFPA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |