C16H24BrNS — CID 102827092
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-bromo-5-methylthiophen-2-yl)methanamine (PubChem CID 102827092) has the molecular formula C16H24BrNS and a molecular weight of 342.35 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-bromo-5-methylthiophen-2-yl)methanamine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-bromo-5-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 102827092 |
| Molecular Formula | C16H24BrNS |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-bromo-5-methylthiophen-2-yl)methanamine |
| SMILES | Cc1sc(C(N)C2CCC3CCCCC3C2)cc1Br |
| InChI | InChI=1S/C16H24BrNS/c1-10-14(17)9-15(19-10)16(18)13-7-6-11-4-2-3-5-12(11)8-13/h9,11-13,16H,2-8,18H2,1H3 |
| InChIKey | XVNJDWUQUBRQNZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |