C12H18BrNS — CID 171203284
(R)-(5-bromo-4-methylthiophen-2-yl)-cyclohexylmethanamine (PubChem CID 171203284) has the molecular formula C12H18BrNS and a molecular weight of 288.25 g/mol. Its IUPAC name is (R)-(5-bromo-4-methylthiophen-2-yl)-cyclohexylmethanamine.
| Compound Name | (R)-(5-bromo-4-methylthiophen-2-yl)-cyclohexylmethanamine |
|---|---|
| PubChem CID | 171203284 |
| Molecular Formula | C12H18BrNS |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | (R)-(5-bromo-4-methylthiophen-2-yl)-cyclohexylmethanamine |
| SMILES | Cc1cc([C@H](N)C2CCCCC2)sc1Br |
| InChI | InChI=1S/C12H18BrNS/c1-8-7-10(15-12(8)13)11(14)9-5-3-2-4-6-9/h7,9,11H,2-6,14H2,1H3/t11-/m1/s1 |
| InChIKey | KWRWNEGMCFBMLL-LLVKDONJSA-N |
| XLogP | 4.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |