C10H15BrClNS — CID 171203275
(1R)-1-(5-bromo-4-methylthiophen-2-yl)-2-cyclopropylethanamine;hydrochloride (PubChem CID 171203275) has the molecular formula C10H15BrClNS and a molecular weight of 296.66 g/mol. Its IUPAC name is (1R)-1-(5-bromo-4-methylthiophen-2-yl)-2-cyclopropylethanamine;hydrochloride.
| Compound Name | (1R)-1-(5-bromo-4-methylthiophen-2-yl)-2-cyclopropylethanamine;hydrochloride |
|---|---|
| PubChem CID | 171203275 |
| Molecular Formula | C10H15BrClNS |
| Molecular Weight | 296.66 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | (1R)-1-(5-bromo-4-methylthiophen-2-yl)-2-cyclopropylethanamine;hydrochloride |
| SMILES | Cc1cc([C@H](N)CC2CC2)sc1Br.Cl |
| InChI | InChI=1S/C10H14BrNS.ClH/c1-6-4-9(13-10(6)11)8(12)5-7-2-3-7;/h4,7-8H,2-3,5,12H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | XLZKUVDYHYBDSJ-DDWIOCJRSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |