C9H15BrClNOS — CID 171222868
(4S)-4-amino-4-(5-bromo-4-methylthiophen-2-yl)butan-1-ol;hydrochloride (PubChem CID 171222868) has the molecular formula C9H15BrClNOS and a molecular weight of 300.65 g/mol. Its IUPAC name is (4S)-4-amino-4-(5-bromo-4-methylthiophen-2-yl)butan-1-ol;hydrochloride.
| Compound Name | (4S)-4-amino-4-(5-bromo-4-methylthiophen-2-yl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171222868 |
| Molecular Formula | C9H15BrClNOS |
| Molecular Weight | 300.65 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | (4S)-4-amino-4-(5-bromo-4-methylthiophen-2-yl)butan-1-ol;hydrochloride |
| SMILES | Cc1cc([C@@H](N)CCCO)sc1Br.Cl |
| InChI | InChI=1S/C9H14BrNOS.ClH/c1-6-5-8(13-9(6)10)7(11)3-2-4-12;/h5,7,12H,2-4,11H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | IPRKNPMXPGPSKW-FJXQXJEOSA-N |
| XLogP | 3.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |