C10H16BrNOS — CID 105013420
1-(5-bromo-4-methylthiophen-2-yl)-2-propan-2-yloxyethanamine (PubChem CID 105013420) has the molecular formula C10H16BrNOS and a molecular weight of 278.22 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)-2-propan-2-yloxyethanamine.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 105013420 |
| Molecular Formula | C10H16BrNOS |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)-2-propan-2-yloxyethanamine |
| SMILES | Cc1cc(C(N)COC(C)C)sc1Br |
| InChI | InChI=1S/C10H16BrNOS/c1-6(2)13-5-8(12)9-4-7(3)10(11)14-9/h4,6,8H,5,12H2,1-3H3 |
| InChIKey | DFTJAWCQJAEXLV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |