C12H14ClN — CID 134893755
2-chloro-2-(2,3,5,6-tetramethylphenyl)acetonitrile (PubChem CID 134893755) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is 2-chloro-2-(2,3,5,6-tetramethylphenyl)acetonitrile.
| Compound Name | 2-chloro-2-(2,3,5,6-tetramethylphenyl)acetonitrile |
|---|---|
| PubChem CID | 134893755 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-chloro-2-(2,3,5,6-tetramethylphenyl)acetonitrile |
| SMILES | Cc1cc(C)c(C)c(C(Cl)C#N)c1C |
| InChI | InChI=1S/C12H14ClN/c1-7-5-8(2)10(4)12(9(7)3)11(13)6-14/h5,11H,1-4H3 |
| InChIKey | HAQBLNWSXLQTRU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|