C15H12N4O4 — CID 175842723
[cyanato-[3-(dicyanatomethyl)-2,4,6-trimethylphenyl]methyl] cyanate (PubChem CID 175842723) has the molecular formula C15H12N4O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is [cyanato-[3-(dicyanatomethyl)-2,4,6-trimethylphenyl]methyl] cyanate.
| Compound Name | [cyanato-[3-(dicyanatomethyl)-2,4,6-trimethylphenyl]methyl] cyanate |
|---|---|
| PubChem CID | 175842723 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [cyanato-[3-(dicyanatomethyl)-2,4,6-trimethylphenyl]methyl] cyanate |
| SMILES | Cc1cc(C)c(C(OC#N)OC#N)c(C)c1C(OC#N)OC#N |
| InChI | InChI=1S/C15H12N4O4/c1-9-4-10(2)13(15(22-7-18)23-8-19)11(3)12(9)14(20-5-16)21-6-17/h4,14-15H,1-3H3 |
| InChIKey | IXYAVTYKIZTUJG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 132.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|