About 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane
1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane (PubChem CID 145387685) has the molecular formula C16H28
and a molecular weight of 220.40 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane.
Molecular Properties
| Compound Name | 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane |
| PubChem CID | 145387685 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane |
| SMILES | CC.Cc1ccc(C(C)C)c(C)c1C(C)C |
| InChI | InChI=1S/C14H22.C2H6/c1-9(2)13-8-7-11(5)14(10(3)4)12(13)6;1-2/h7-10H,1-6H3;1-2H3 |
| InChIKey | BMJBVFWWSDEOSN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane?
The IUPAC name of 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane (CID 145387685) is 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane.
What is the SMILES notation for 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane?
The canonical SMILES for 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane is CC.Cc1ccc(C(C)C)c(C)c1C(C)C.
What is the InChIKey of 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane?
The InChIKey is BMJBVFWWSDEOSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.C2H6/c1-9(2)13-8-7-11(5)14(10(3)4)12(13)6;1-2/h7-10H,1-6H3;1-2H3.
What are the key properties of 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane?
1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane has a molecular weight of 220.40 g/mol, XLogP of 5.58, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2,4-di(propan-2-yl)benzene;ethane is sourced from PubChem (CID 145387685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).