About 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane
1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane (PubChem CID 155737833) has the molecular formula C15H25Cl
and a molecular weight of 240.82 g/mol. Its IUPAC name is 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane.
Analyze 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane?
The IUPAC name of 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane (CID 155737833) is 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane.
What is the SMILES notation for 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane?
The canonical SMILES for 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane is CC.Cc1c(C(C)C)ccc(Cl)c1C(C)C.
What is the InChIKey of 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane?
The InChIKey is AGXOGPLJMFJTGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Cl.C2H6/c1-8(2)11-6-7-12(14)13(9(3)4)10(11)5;1-2/h6-9H,1-5H3;1-2H3.
What are the key properties of 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane?
1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane has a molecular weight of 240.82 g/mol, XLogP of 5.92, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-methyl-2,4-di(propan-2-yl)benzene;ethane is sourced from PubChem (CID 155737833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).