C16H26ClNO — CID 145387733
N-[3-chloro-2,6-di(propan-2-yl)phenyl]acetamide;ethane (PubChem CID 145387733) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is N-[3-chloro-2,6-di(propan-2-yl)phenyl]acetamide;ethane.
| Compound Name | N-[3-chloro-2,6-di(propan-2-yl)phenyl]acetamide;ethane |
|---|---|
| PubChem CID | 145387733 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-[3-chloro-2,6-di(propan-2-yl)phenyl]acetamide;ethane |
| SMILES | CC.CC(=O)Nc1c(C(C)C)ccc(Cl)c1C(C)C |
| InChI | InChI=1S/C14H20ClNO.C2H6/c1-8(2)11-6-7-12(15)13(9(3)4)14(11)16-10(5)17;1-2/h6-9H,1-5H3,(H,16,17);1-2H3 |
| InChIKey | MGOTUMOEYPAAET-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |