C14H20ClNO — CID 167302174
N-[4-chloro-2,5-di(propan-2-yl)phenyl]acetamide (PubChem CID 167302174) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is N-[4-chloro-2,5-di(propan-2-yl)phenyl]acetamide.
| Compound Name | N-[4-chloro-2,5-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 167302174 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-[4-chloro-2,5-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(C)C)c(Cl)cc1C(C)C |
| InChI | InChI=1S/C14H20ClNO/c1-8(2)11-7-14(16-10(5)17)12(9(3)4)6-13(11)15/h6-9H,1-5H3,(H,16,17) |
| InChIKey | BVZJGGDJMMTPAN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |