C12H19NO — CID 116947379
1-(2-methoxy-3,4,6-trimethylphenyl)ethanamine (PubChem CID 116947379) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(2-methoxy-3,4,6-trimethylphenyl)ethanamine.
| Compound Name | 1-(2-methoxy-3,4,6-trimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 116947379 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-(2-methoxy-3,4,6-trimethylphenyl)ethanamine |
| SMILES | COc1c(C)c(C)cc(C)c1C(C)N |
| InChI | InChI=1S/C12H19NO/c1-7-6-8(2)11(10(4)13)12(14-5)9(7)3/h6,10H,13H2,1-5H3 |
| InChIKey | CEEXUFFEXYQARW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |