C12H19NOS — CID 116868705
2-amino-1-(2-methoxy-3,4,6-trimethylphenyl)ethanethiol (PubChem CID 116868705) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-amino-1-(2-methoxy-3,4,6-trimethylphenyl)ethanethiol.
| Compound Name | 2-amino-1-(2-methoxy-3,4,6-trimethylphenyl)ethanethiol |
|---|---|
| PubChem CID | 116868705 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-amino-1-(2-methoxy-3,4,6-trimethylphenyl)ethanethiol |
| SMILES | COc1c(C)c(C)cc(C)c1C(S)CN |
| InChI | InChI=1S/C12H19NOS/c1-7-5-8(2)11(10(15)6-13)12(14-4)9(7)3/h5,10,15H,6,13H2,1-4H3 |
| InChIKey | DXTCUDBNTBSNLZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|