C13H21NOS — CID 116830729
2-(2-methoxy-3,4,6-trimethylphenyl)-2-(methylamino)ethanethiol (PubChem CID 116830729) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 2-(2-methoxy-3,4,6-trimethylphenyl)-2-(methylamino)ethanethiol.
| Compound Name | 2-(2-methoxy-3,4,6-trimethylphenyl)-2-(methylamino)ethanethiol |
|---|---|
| PubChem CID | 116830729 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-(2-methoxy-3,4,6-trimethylphenyl)-2-(methylamino)ethanethiol |
| SMILES | CNC(CS)c1c(C)cc(C)c(C)c1OC |
| InChI | InChI=1S/C13H21NOS/c1-8-6-9(2)12(11(7-16)14-4)13(15-5)10(8)3/h6,11,14,16H,7H2,1-5H3 |
| InChIKey | LONAZNCJEFIVRF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|