C13H19ClO2 — CID 116863758
2-chloro-1-(2-methoxy-3,4,6-trimethylphenyl)propan-1-ol (PubChem CID 116863758) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-chloro-1-(2-methoxy-3,4,6-trimethylphenyl)propan-1-ol.
| Compound Name | 2-chloro-1-(2-methoxy-3,4,6-trimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 116863758 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-chloro-1-(2-methoxy-3,4,6-trimethylphenyl)propan-1-ol |
| SMILES | COc1c(C)c(C)cc(C)c1C(O)C(C)Cl |
| InChI | InChI=1S/C13H19ClO2/c1-7-6-8(2)11(12(15)10(4)14)13(16-5)9(7)3/h6,10,12,15H,1-5H3 |
| InChIKey | REZOWDSVFCECJG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|