C11H10O5 — CID 75361247
5,8-dihydroxy-7-methoxy-2-methylchromen-4-one (PubChem CID 75361247) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is 5,8-dihydroxy-7-methoxy-2-methylchromen-4-one.
| Compound Name | 5,8-dihydroxy-7-methoxy-2-methylchromen-4-one |
|---|---|
| PubChem CID | 75361247 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 5,8-dihydroxy-7-methoxy-2-methylchromen-4-one |
| SMILES | COc1cc(O)c2c(=O)cc(C)oc2c1O |
| InChI | InChI=1S/C11H10O5/c1-5-3-6(12)9-7(13)4-8(15-2)10(14)11(9)16-5/h3-4,13-14H,1-2H3 |
| InChIKey | BKQAYUHMNRDJTR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|