C16H18O5 — CID 163020135
5-hydroxy-8-[(2S)-2-hydroxy-3-methylbut-3-enyl]-7-methoxy-2-methylchromen-4-one (PubChem CID 163020135) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-hydroxy-8-[(2S)-2-hydroxy-3-methylbut-3-enyl]-7-methoxy-2-methylchromen-4-one.
| Compound Name | 5-hydroxy-8-[(2S)-2-hydroxy-3-methylbut-3-enyl]-7-methoxy-2-methylchromen-4-one |
|---|---|
| PubChem CID | 163020135 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 5-hydroxy-8-[(2S)-2-hydroxy-3-methylbut-3-enyl]-7-methoxy-2-methylchromen-4-one |
| SMILES | C=C(C)[C@@H](O)Cc1c(OC)cc(O)c2c(=O)cc(C)oc12 |
| InChI | InChI=1S/C16H18O5/c1-8(2)11(17)6-10-14(20-4)7-13(19)15-12(18)5-9(3)21-16(10)15/h5,7,11,17,19H,1,6H2,2-4H3/t11-/m0/s1 |
| InChIKey | HPHRKLAQYUCXBZ-NSHDSACASA-N |
| XLogP | 2.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|