C22H22O6 — CID 141471053
5-hydroxy-2-(4-hydroxy-2-methoxyphenyl)-7-methoxy-8-(3-methylbut-3-enyl)chromen-4-one (PubChem CID 141471053) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 5-hydroxy-2-(4-hydroxy-2-methoxyphenyl)-7-methoxy-8-(3-methylbut-3-enyl)chromen-4-one.
| Compound Name | 5-hydroxy-2-(4-hydroxy-2-methoxyphenyl)-7-methoxy-8-(3-methylbut-3-enyl)chromen-4-one |
|---|---|
| PubChem CID | 141471053 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 5-hydroxy-2-(4-hydroxy-2-methoxyphenyl)-7-methoxy-8-(3-methylbut-3-enyl)chromen-4-one |
| SMILES | C=C(C)CCc1c(OC)cc(O)c2c(=O)cc(-c3ccc(O)cc3OC)oc12 |
| InChI | InChI=1S/C22H22O6/c1-12(2)5-7-15-19(27-4)10-16(24)21-17(25)11-20(28-22(15)21)14-8-6-13(23)9-18(14)26-3/h6,8-11,23-24H,1,5,7H2,2-4H3 |
| InChIKey | PEBNWUHOABDBBH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|