C18H22O6 — CID 139586252
5-hydroxy-6-(5-hydroxy-2-methyl-3-oxohexyl)-7-methoxy-2-methylchromen-4-one (PubChem CID 139586252) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is 5-hydroxy-6-(5-hydroxy-2-methyl-3-oxohexyl)-7-methoxy-2-methylchromen-4-one.
| Compound Name | 5-hydroxy-6-(5-hydroxy-2-methyl-3-oxohexyl)-7-methoxy-2-methylchromen-4-one |
|---|---|
| PubChem CID | 139586252 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-hydroxy-6-(5-hydroxy-2-methyl-3-oxohexyl)-7-methoxy-2-methylchromen-4-one |
| SMILES | COc1cc2oc(C)cc(=O)c2c(O)c1CC(C)C(=O)CC(C)O |
| InChI | InChI=1S/C18H22O6/c1-9(13(20)6-10(2)19)5-12-15(23-4)8-16-17(18(12)22)14(21)7-11(3)24-16/h7-10,19,22H,5-6H2,1-4H3 |
| InChIKey | IIUMSUVLRUBHEB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |