C16H16O5 — CID 53321196
5-hydroxy-2-methyl-6,7-bis(prop-2-enoxy)chromen-4-one (PubChem CID 53321196) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-6,7-bis(prop-2-enoxy)chromen-4-one.
| Compound Name | 5-hydroxy-2-methyl-6,7-bis(prop-2-enoxy)chromen-4-one |
|---|---|
| PubChem CID | 53321196 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 5-hydroxy-2-methyl-6,7-bis(prop-2-enoxy)chromen-4-one |
| SMILES | C=CCOc1cc2oc(C)cc(=O)c2c(O)c1OCC=C |
| InChI | InChI=1S/C16H16O5/c1-4-6-19-13-9-12-14(11(17)8-10(3)21-12)15(18)16(13)20-7-5-2/h4-5,8-9,18H,1-2,6-7H2,3H3 |
| InChIKey | MOTNQMLZPQLTFA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|