C20H22O7 — CID 144525991
2-[(1E,3Z,5Z)-3,4-dimethoxyhepta-1,3,5-trienyl]-5-hydroxy-6,7-dimethoxychromen-4-one (PubChem CID 144525991) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[(1E,3Z,5Z)-3,4-dimethoxyhepta-1,3,5-trienyl]-5-hydroxy-6,7-dimethoxychromen-4-one.
| Compound Name | 2-[(1E,3Z,5Z)-3,4-dimethoxyhepta-1,3,5-trienyl]-5-hydroxy-6,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 144525991 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[(1E,3Z,5Z)-3,4-dimethoxyhepta-1,3,5-trienyl]-5-hydroxy-6,7-dimethoxychromen-4-one |
| SMILES | C/C=C\C(OC)=C(/C=C/c1cc(=O)c2c(O)c(OC)c(OC)cc2o1)OC |
| InChI | InChI=1S/C20H22O7/c1-6-7-14(23-2)15(24-3)9-8-12-10-13(21)18-16(27-12)11-17(25-4)20(26-5)19(18)22/h6-11,22H,1-5H3/b7-6-,9-8+,15-14- |
| InChIKey | RGRYABYZVIYZFC-DFFNJDSASA-N |
| XLogP | 3.61 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|