C11H10O3 — CID 170989896
5-hydroxy-2,6-dimethylchromen-4-one (PubChem CID 170989896) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-hydroxy-2,6-dimethylchromen-4-one.
| Compound Name | 5-hydroxy-2,6-dimethylchromen-4-one |
|---|---|
| PubChem CID | 170989896 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 5-hydroxy-2,6-dimethylchromen-4-one |
| SMILES | Cc1cc(=O)c2c(O)c(C)ccc2o1 |
| InChI | InChI=1S/C11H10O3/c1-6-3-4-9-10(11(6)13)8(12)5-7(2)14-9/h3-5,13H,1-2H3 |
| InChIKey | KNBYSBDHHIBOLL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |