C13H8O5 — CID 42631475
5-hydroxy-8-methylpyrano[3,2-g]chromene-2,6-dione (PubChem CID 42631475) has the molecular formula C13H8O5 and a molecular weight of 244.20 g/mol. Its IUPAC name is 5-hydroxy-8-methylpyrano[3,2-g]chromene-2,6-dione.
| Compound Name | 5-hydroxy-8-methylpyrano[3,2-g]chromene-2,6-dione |
|---|---|
| PubChem CID | 42631475 |
| Molecular Formula | C13H8O5 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 5-hydroxy-8-methylpyrano[3,2-g]chromene-2,6-dione |
| SMILES | Cc1cc(=O)c2c(O)c3ccc(=O)oc3cc2o1 |
| InChI | InChI=1S/C13H8O5/c1-6-4-8(14)12-10(17-6)5-9-7(13(12)16)2-3-11(15)18-9/h2-5,16H,1H3 |
| InChIKey | DZFMQKSVLSHMDQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|