C11H10O2 — CID 2343140
2,7-dimethylchromen-4-one (PubChem CID 2343140) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2,7-dimethylchromen-4-one.
| Compound Name | 2,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 2343140 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2,7-dimethylchromen-4-one |
| SMILES | Cc1ccc2c(=O)cc(C)oc2c1 |
| InChI | InChI=1S/C11H10O2/c1-7-3-4-9-10(12)6-8(2)13-11(9)5-7/h3-6H,1-2H3 |
| InChIKey | ZPFCSSUWRXOPPB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |