About methanamine;2-methylchromen-4-one
methanamine;2-methylchromen-4-one (PubChem CID 91311034) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is methanamine;2-methylchromen-4-one.
Molecular Properties
| Compound Name | methanamine;2-methylchromen-4-one |
| PubChem CID | 91311034 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | methanamine;2-methylchromen-4-one |
| SMILES | CN.Cc1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C10H8O2.CH5N/c1-7-6-9(11)8-4-2-3-5-10(8)12-7;1-2/h2-6H,1H3;2H2,1H3 |
| InChIKey | YEQQYFBLSPVACI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanamine;2-methylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-methylchromen-4-one?
The IUPAC name of methanamine;2-methylchromen-4-one (CID 91311034) is methanamine;2-methylchromen-4-one.
What is the SMILES notation for methanamine;2-methylchromen-4-one?
The canonical SMILES for methanamine;2-methylchromen-4-one is CN.Cc1cc(=O)c2ccccc2o1.
What is the InChIKey of methanamine;2-methylchromen-4-one?
The InChIKey is YEQQYFBLSPVACI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.CH5N/c1-7-6-9(11)8-4-2-3-5-10(8)12-7;1-2/h2-6H,1H3;2H2,1H3.
What are the key properties of methanamine;2-methylchromen-4-one?
methanamine;2-methylchromen-4-one has a molecular weight of 191.23 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-methylchromen-4-one is sourced from PubChem (CID 91311034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).