C15H14O3 — CID 142130778
2-[(2Z,4Z)-2-hydroxyhexa-2,4-dien-3-yl]chromen-4-one (PubChem CID 142130778) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-[(2Z,4Z)-2-hydroxyhexa-2,4-dien-3-yl]chromen-4-one.
| Compound Name | 2-[(2Z,4Z)-2-hydroxyhexa-2,4-dien-3-yl]chromen-4-one |
|---|---|
| PubChem CID | 142130778 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[(2Z,4Z)-2-hydroxyhexa-2,4-dien-3-yl]chromen-4-one |
| SMILES | C/C=C\C(=C(/C)O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C15H14O3/c1-3-6-11(10(2)16)15-9-13(17)12-7-4-5-8-14(12)18-15/h3-9,16H,1-2H3/b6-3-,11-10- |
| InChIKey | XKOUJWZHSCIUOD-XXNLUHFVSA-N |
| XLogP | 3.66 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|