(5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate

C16H14O8S — CID 101293590

IUPAC(5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate
SMILESCOc1cc(OS(=O)(=O)O)cc2cc3oc(C)cc(=O)c3c(OC)c12
InChIInChI=1S/C16H14O8S/c1-8-4-11(17)15-13(23-8)6-9-5-10(24-25(18,19)20)7-12(21-2)14(9)16(15)22-3/h4-7H,1-3H3,(H,18,19,20)
InChIKeyAOHAGQJHBXOCFE-UHFFFAOYSA-N
MW366.35 g/mol
LogP2.45
Rot. Bonds4

About (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate

(5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate (PubChem CID 101293590) has the molecular formula C16H14O8S and a molecular weight of 366.35 g/mol. Its IUPAC name is (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate.

Molecular Properties

Compound Name(5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate
PubChem CID101293590
Molecular FormulaC16H14O8S
Molecular Weight366.35 g/mol
Exact Mass366.04
IUPAC Name(5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate
SMILESCOc1cc(OS(=O)(=O)O)cc2cc3oc(C)cc(=O)c3c(OC)c12
InChIInChI=1S/C16H14O8S/c1-8-4-11(17)15-13(23-8)6-9-5-10(24-25(18,19)20)7-12(21-2)14(9)16(15)22-3/h4-7H,1-3H3,(H,18,19,20)
InChIKeyAOHAGQJHBXOCFE-UHFFFAOYSA-N
XLogP2.45
TPSA112.27 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.35
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate?
The IUPAC name of (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate (CID 101293590) is (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate.
What is the SMILES notation for (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate?
The canonical SMILES for (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate is COc1cc(OS(=O)(=O)O)cc2cc3oc(C)cc(=O)c3c(OC)c12.
What is the InChIKey of (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate?
The InChIKey is AOHAGQJHBXOCFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O8S/c1-8-4-11(17)15-13(23-8)6-9-5-10(24-25(18,19)20)7-12(21-2)14(9)16(15)22-3/h4-7H,1-3H3,(H,18,19,20).
What are the key properties of (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate?
(5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate has a molecular weight of 366.35 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate is sourced from PubChem (CID 101293590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).