C16H14O8S — CID 101293590
(5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate (PubChem CID 101293590) has the molecular formula C16H14O8S and a molecular weight of 366.35 g/mol. Its IUPAC name is (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate.
| Compound Name | (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 101293590 |
| Molecular Formula | C16H14O8S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (5,6-dimethoxy-2-methyl-4-oxobenzo[g]chromen-8-yl) hydrogen sulfate |
| SMILES | COc1cc(OS(=O)(=O)O)cc2cc3oc(C)cc(=O)c3c(OC)c12 |
| InChI | InChI=1S/C16H14O8S/c1-8-4-11(17)15-13(23-8)6-9-5-10(24-25(18,19)20)7-12(21-2)14(9)16(15)22-3/h4-7H,1-3H3,(H,18,19,20) |
| InChIKey | AOHAGQJHBXOCFE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|