C22H18O5 — CID 46844185
2-benzyl-5-hydroxy-6,8-dimethoxybenzo[g]chromen-4-one (PubChem CID 46844185) has the molecular formula C22H18O5 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-benzyl-5-hydroxy-6,8-dimethoxybenzo[g]chromen-4-one.
| Compound Name | 2-benzyl-5-hydroxy-6,8-dimethoxybenzo[g]chromen-4-one |
|---|---|
| PubChem CID | 46844185 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-benzyl-5-hydroxy-6,8-dimethoxybenzo[g]chromen-4-one |
| SMILES | COc1cc(OC)c2c(O)c3c(=O)cc(Cc4ccccc4)oc3cc2c1 |
| InChI | InChI=1S/C22H18O5/c1-25-15-9-14-10-19-21(22(24)20(14)18(12-15)26-2)17(23)11-16(27-19)8-13-6-4-3-5-7-13/h3-7,9-12,24H,8H2,1-2H3 |
| InChIKey | LSWQVEMBAYSPJE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|