C17H14O5S — CID 22906521
2-(2-hydroxyphenyl)sulfanyl-5,7-dimethoxychromen-4-one (PubChem CID 22906521) has the molecular formula C17H14O5S and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)sulfanyl-5,7-dimethoxychromen-4-one.
| Compound Name | 2-(2-hydroxyphenyl)sulfanyl-5,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 22906521 |
| Molecular Formula | C17H14O5S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-(2-hydroxyphenyl)sulfanyl-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(Sc3ccccc3O)oc2c1 |
| InChI | InChI=1S/C17H14O5S/c1-20-10-7-13(21-2)17-12(19)9-16(22-14(17)8-10)23-15-6-4-3-5-11(15)18/h3-9,18H,1-2H3 |
| InChIKey | RTXQTQWOULPQJH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |