C23H26N2O4 — CID 127042921
5,7-dimethoxy-2-[4-(2-phenylethyl)piperazin-1-yl]chromen-4-one (PubChem CID 127042921) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 5,7-dimethoxy-2-[4-(2-phenylethyl)piperazin-1-yl]chromen-4-one.
| Compound Name | 5,7-dimethoxy-2-[4-(2-phenylethyl)piperazin-1-yl]chromen-4-one |
|---|---|
| PubChem CID | 127042921 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 5,7-dimethoxy-2-[4-(2-phenylethyl)piperazin-1-yl]chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(N3CCN(CCc4ccccc4)CC3)oc2c1 |
| InChI | InChI=1S/C23H26N2O4/c1-27-18-14-20(28-2)23-19(26)16-22(29-21(23)15-18)25-12-10-24(11-13-25)9-8-17-6-4-3-5-7-17/h3-7,14-16H,8-13H2,1-2H3 |
| InChIKey | OHLPEDRWIREBEI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |