C23H23N3O4 — CID 127042305
4-[[4-(5,7-dimethoxy-4-oxochromen-2-yl)piperazin-1-yl]methyl]benzonitrile (PubChem CID 127042305) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 4-[[4-(5,7-dimethoxy-4-oxochromen-2-yl)piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(5,7-dimethoxy-4-oxochromen-2-yl)piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 127042305 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-[[4-(5,7-dimethoxy-4-oxochromen-2-yl)piperazin-1-yl]methyl]benzonitrile |
| SMILES | COc1cc(OC)c2c(=O)cc(N3CCN(Cc4ccc(C#N)cc4)CC3)oc2c1 |
| InChI | InChI=1S/C23H23N3O4/c1-28-18-11-20(29-2)23-19(27)13-22(30-21(23)12-18)26-9-7-25(8-10-26)15-17-5-3-16(14-24)4-6-17/h3-6,11-13H,7-10,15H2,1-2H3 |
| InChIKey | VYJOKCBNDLDJEC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |