C29H24O6 — CID 102527760
7,9-dimethoxy-2,3-bis(phenylmethoxy)benzo[c]chromen-6-one (PubChem CID 102527760) has the molecular formula C29H24O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is 7,9-dimethoxy-2,3-bis(phenylmethoxy)benzo[c]chromen-6-one.
| Compound Name | 7,9-dimethoxy-2,3-bis(phenylmethoxy)benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 102527760 |
| Molecular Formula | C29H24O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 7,9-dimethoxy-2,3-bis(phenylmethoxy)benzo[c]chromen-6-one |
| SMILES | COc1cc(OC)c2c(=O)oc3cc(OCc4ccccc4)c(OCc4ccccc4)cc3c2c1 |
| InChI | InChI=1S/C29H24O6/c1-31-21-13-23-22-15-25(33-17-19-9-5-3-6-10-19)26(34-18-20-11-7-4-8-12-20)16-24(22)35-29(30)28(23)27(14-21)32-2/h3-16H,17-18H2,1-2H3 |
| InChIKey | FBADTWCPQXKBHS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|