C27H28O7 — CID 53374452
3-[(3,5-dimethoxyphenyl)methoxy]-8-(2-hydroxybutan-2-yl)-2-methoxybenzo[c]chromen-6-one (PubChem CID 53374452) has the molecular formula C27H28O7 and a molecular weight of 464.51 g/mol. Its IUPAC name is 3-[(3,5-dimethoxyphenyl)methoxy]-8-(2-hydroxybutan-2-yl)-2-methoxybenzo[c]chromen-6-one.
| Compound Name | 3-[(3,5-dimethoxyphenyl)methoxy]-8-(2-hydroxybutan-2-yl)-2-methoxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 53374452 |
| Molecular Formula | C27H28O7 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 3-[(3,5-dimethoxyphenyl)methoxy]-8-(2-hydroxybutan-2-yl)-2-methoxybenzo[c]chromen-6-one |
| SMILES | CCC(C)(O)c1ccc2c(c1)c(=O)oc1cc(OCc3cc(OC)cc(OC)c3)c(OC)cc12 |
| InChI | InChI=1S/C27H28O7/c1-6-27(2,29)17-7-8-20-21-13-24(32-5)25(14-23(21)34-26(28)22(20)11-17)33-15-16-9-18(30-3)12-19(10-16)31-4/h7-14,29H,6,15H2,1-5H3 |
| InChIKey | RTXRJFLHFJHTFV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|