C32H28O6 — CID 154040845
3-[(4-benzoylphenyl)methoxy]-8-(4-hydroxybutan-2-yl)-2-methoxybenzo[c]chromen-6-one (PubChem CID 154040845) has the molecular formula C32H28O6 and a molecular weight of 508.57 g/mol. Its IUPAC name is 3-[(4-benzoylphenyl)methoxy]-8-(4-hydroxybutan-2-yl)-2-methoxybenzo[c]chromen-6-one.
| Compound Name | 3-[(4-benzoylphenyl)methoxy]-8-(4-hydroxybutan-2-yl)-2-methoxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 154040845 |
| Molecular Formula | C32H28O6 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 3-[(4-benzoylphenyl)methoxy]-8-(4-hydroxybutan-2-yl)-2-methoxybenzo[c]chromen-6-one |
| SMILES | COc1cc2c(cc1OCc1ccc(C(=O)c3ccccc3)cc1)oc(=O)c1cc(C(C)CCO)ccc12 |
| InChI | InChI=1S/C32H28O6/c1-20(14-15-33)24-12-13-25-26-17-29(36-2)30(18-28(26)38-32(35)27(25)16-24)37-19-21-8-10-23(11-9-21)31(34)22-6-4-3-5-7-22/h3-13,16-18,20,33H,14-15,19H2,1-2H3 |
| InChIKey | AAHPTLHFMOZNGE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|