C32H28O4S — CID 143579293
2-[(4-benzoylphenyl)methoxy]-3-methoxy-7-(1-methylsulfanylethyl)-10H-phenanthren-9-one (PubChem CID 143579293) has the molecular formula C32H28O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is 2-[(4-benzoylphenyl)methoxy]-3-methoxy-7-(1-methylsulfanylethyl)-10H-phenanthren-9-one.
| Compound Name | 2-[(4-benzoylphenyl)methoxy]-3-methoxy-7-(1-methylsulfanylethyl)-10H-phenanthren-9-one |
|---|---|
| PubChem CID | 143579293 |
| Molecular Formula | C32H28O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 2-[(4-benzoylphenyl)methoxy]-3-methoxy-7-(1-methylsulfanylethyl)-10H-phenanthren-9-one |
| SMILES | COc1cc2c(cc1OCc1ccc(C(=O)c3ccccc3)cc1)CC(=O)c1cc(C(C)SC)ccc1-2 |
| InChI | InChI=1S/C32H28O4S/c1-20(37-3)24-13-14-26-27-18-30(35-2)31(17-25(27)16-29(33)28(26)15-24)36-19-21-9-11-23(12-10-21)32(34)22-7-5-4-6-8-22/h4-15,17-18,20H,16,19H2,1-3H3 |
| InChIKey | LTOOIJKNJWGWOJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |