About 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one
3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one (PubChem CID 10810185) has the molecular formula C25H22O4
and a molecular weight of 386.45 g/mol. Its IUPAC name is 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one.
Molecular Properties
| Compound Name | 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one |
| PubChem CID | 10810185 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one |
| SMILES | Cc1c(C)c2cc(OCc3ccccc3)c(OCc3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C25H22O4/c1-17-18(2)25(26)29-22-14-24(28-16-20-11-7-4-8-12-20)23(13-21(17)22)27-15-19-9-5-3-6-10-19/h3-14H,15-16H2,1-2H3 |
| InChIKey | YKJXDTJLDGKBET-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one?
The IUPAC name of 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one (CID 10810185) is 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one.
What is the SMILES notation for 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one?
The canonical SMILES for 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one is Cc1c(C)c2cc(OCc3ccccc3)c(OCc3ccccc3)cc2oc1=O.
What is the InChIKey of 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one?
The InChIKey is YKJXDTJLDGKBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O4/c1-17-18(2)25(26)29-22-14-24(28-16-20-11-7-4-8-12-20)23(13-21(17)22)27-15-19-9-5-3-6-10-19/h3-14H,15-16H2,1-2H3.
What are the key properties of 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one?
3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one has a molecular weight of 386.45 g/mol, XLogP of 5.57, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-6,7-bis(phenylmethoxy)chromen-2-one is sourced from PubChem (CID 10810185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).