C15H12O5 — CID 169439551
3-hydroxy-8,10-dimethoxybenzo[c]chromen-6-one (PubChem CID 169439551) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 3-hydroxy-8,10-dimethoxybenzo[c]chromen-6-one.
| Compound Name | 3-hydroxy-8,10-dimethoxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 169439551 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-hydroxy-8,10-dimethoxybenzo[c]chromen-6-one |
| SMILES | COc1cc(OC)c2c(c1)c(=O)oc1cc(O)ccc12 |
| InChI | InChI=1S/C15H12O5/c1-18-9-6-11-14(13(7-9)19-2)10-4-3-8(16)5-12(10)20-15(11)17/h3-7,16H,1-2H3 |
| InChIKey | ZMZUANGKUDGEET-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|