C21H21NO6 — CID 6236159
N-[(2,4-dimethoxyphenyl)methyl]-2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetamide (PubChem CID 6236159) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 6236159 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
| SMILES | COc1ccc(CNC(=O)Cc2c(C)c3ccc(O)cc3oc2=O)c(OC)c1 |
| InChI | InChI=1S/C21H21NO6/c1-12-16-7-5-14(23)8-19(16)28-21(25)17(12)10-20(24)22-11-13-4-6-15(26-2)9-18(13)27-3/h4-9,23H,10-11H2,1-3H3,(H,22,24) |
| InChIKey | MFTXHKISMCULTD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|