C37H31NO8 — CID 10897402
12-(3,4-dimethoxyphenyl)-8,16,17-trimethoxy-7-phenylmethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one (PubChem CID 10897402) has the molecular formula C37H31NO8 and a molecular weight of 617.65 g/mol. Its IUPAC name is 12-(3,4-dimethoxyphenyl)-8,16,17-trimethoxy-7-phenylmethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one.
| Compound Name | 12-(3,4-dimethoxyphenyl)-8,16,17-trimethoxy-7-phenylmethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 10897402 |
| Molecular Formula | C37H31NO8 |
| Molecular Weight | 617.65 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 12-(3,4-dimethoxyphenyl)-8,16,17-trimethoxy-7-phenylmethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
| SMILES | COc1ccc(-c2c3c4cc(OC)c(OCc5ccccc5)cc4oc(=O)c3n3ccc4cc(OC)c(OC)cc4c23)cc1OC |
| InChI | InChI=1S/C37H31NO8/c1-40-26-12-11-23(16-28(26)41-2)33-34-25-18-31(44-5)32(45-20-21-9-7-6-8-10-21)19-27(25)46-37(39)36(34)38-14-13-22-15-29(42-3)30(43-4)17-24(22)35(33)38/h6-19H,20H2,1-5H3 |
| InChIKey | GDNBKGHEKNBQGQ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 90.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|